Reading...
Play button
Play button
Use LEFT and RIGHT arrow keys to navigate between flashcards;
Use UP and DOWN arrow keys to flip the card;
H to show hint;
A reads text to speech;
57 Cards in this Set
- Front
- Back
|
define precision
|
-measure of the reproducibilty of a result
-can be evaluated by standard deviation |
|
|
degrees of freedom are used to calculate confidence interval are...
|
number of data points-1
|
|
|
A government chemist has performed a gravimetric analysis for chloride ion...
|
+/-.31%
|
|
|
When an analytical chemist uses the word accuracy, what's meant?
|
how close the mean from a set of data is to the true value of the composition of the sample anaylzed
|
|
|
A student was presented with a sample of vinegar for analysis...which value for Q rejection?
|
no values may be rejected
|
|
|
Any diluted aqueous solution has a density near 1g/mL...ID which of the following alternative conc expression is correct?
|
1 microgram/L
|
|
|
A solution is prepared by dissolving magnesium chloride in water...calc molarity
|
2.71M
|
|
|
The ethyl alcohol content of many beers...what percent of ethyl alcohol?
|
3.20% ethyl alcohol
|
|
|
Write answers with proper sig figs =12.7290
|
12.7
|
|
|
Find abs uncertainty using sig figs =172.010
|
172.0(+/-.2)
|
|
|
The density of concentrated reagent HCL...Find correct conc.
|
-The Molarity(M) of conc reagent HCL is 12.1
-The molality(m) of conc reagent HCL is 16.1 |
|
|
In medcine, blood sugar is a term...find correct statement.
|
-the normal rnge blood glucose is 3.9-8.4mmol/L
-a high glucose level reading is above 200mg/dL, that converts into as 11.2mmol/L |
|
|
High level of gastric acid...how many tablets of antacid are needed to neautralize?
|
2
|
|
|
Calc abs or relative uncertainty with sig figs
|
NOT 9.23....
|
|
|
Traces of organic, man-made hexachorohexanes in sea sediments...are conc pg/g
|
parts per trillion
|
|
|
pick correct statements
|
the mean conc found by product A is significantly diff from that of conventional procedure
|
|
|
The equation that reps solubility product is...
|
[Mn+3]^2[S-2]^3=Ksp
|
|
|
the debye-huckel equation...which statement(s) will be correct?
|
-As the ionic strenght increases, the activity coeff decreases
|
|
|
Which of the combos of ions and molecules may produce a buffer...?
|
-50mL of .050M HNO3 and 50mL .1M CH3COONa
-50mL .050M NaOH and 100mL .05M CH3COOH |
|
|
What's the pH of solution containing .03333M Ca(NO3)2
|
6.98
|
|
|
If a .100M NaOH...which metal OH will precipitate first?
|
Cu(OH)2
|
|
|
the equivalence point for a titration is...
|
the vol associated with actual stoichiometric quantity of titrant required to complete a titration
|
|
|
magnesium carbonate is slightly soluble in water...what's correct mass balance?
|
[Mg+2]=[CO3-2]+[HCO3-]+[H2CO3]
|
|
|
A solution contains a .100 M Al(NO3)3...what's correct charge balance?
|
3[Al+3]+2[Mg+2]+[H+]=[NO3-]+[Cl-]+[OH-]
|
|
|
Find value of K for reaction HOBr=H+OBr
|
2.0x10-9
|
|
|
If 3 stages of base hydrolysis constantsfor phosphate...which statement is correct?
|
for phosphoric acid, (Ka2=6.29x10-8)
|
|
|
standardization curve...an unknown sample of 100mL of solution containing Cr+3....How many mils of chromium were in the orginal sample?
|
2000mg Cr
|
|
|
Fond conc of phenol and phenolate ion...
|
1.00x10-2M phenol, 1.02x10-6M phenolate ion
|
|
|
a solution contains .100MNa NO3..what's ionic strength?
|
.700M
|
|
|
Regarding the matrix effect...
|
standard additions can min the error caused by the matrix effect
|
|
|
ID all conj acid-base pairs
|
NO2-, HNO2
OH-,H2O |
|
|
A solution containing sodium sulfate has a pNa of 5.83..what's the sulfate conc?
|
7.40x10-7M
|
|
|
how many mils of HNO3 are required to eract with CaCO3
|
194.1mL
|
|
|
regarding ionic strength and activity coeff, which is correct?
|
-activity coeff measures the deviation of behavior of ions from ideality.
-ionic strength measures the total conc of ions in solution. |
|
|
Calc pH of .100 M solution...
|
7.93
|
|
|
A buffer solution was prepared...what's the pH?
|
4.84
|
|
|
Using symbol H2M to rep maleic acid, what's pH and m-2 conc?
|
pH=1.46,[M-2]=4.68x10-7M
|
|
|
Which are true regarding isotonic pt and isoelectric pt?
|
At the isoelectric point, the avg charge of the polyprotic acid is 0, and the conc of H2A+ is equal to the conc of A-
|
|
|
A solution containg 80mL strong acid is titrated with 40mL strong base, what's pH?
|
7.00
|
|
|
A solution containing 50mLof C2H3COOH is titratedwith NaOH, what's pH?
|
4.76
|
|
|
In a titration, 25mL of nitic acis, what's pH?
|
9.42
|
|
|
a beaker containing 500mL was determined to contain ammonia,...what's change in pH?
|
The pH of the solution will go down .087pH units.
|
|
|
Sulforous acid has pKa...at what pH is the HSO3- conc equal to SO3-2 conc?
|
7.18
|
|
|
Consider the titration of 25mL of HBr and NaOH, what's vol of NaOH needed to reach equivalence pt?
|
50mL
|
|
|
EDTA titrations would be most complete?
|
Cu+2 at pH 10
|
|
|
A student wishes to use eriochrome black-T...to adjust pH, the student should use:
|
NH3/NH4+ buffer
|
|
|
cathode defined as...
|
the electrode at which reduction occurs
|
|
|
write balanced net equation for the following cell...
|
2MnO4+16H+5Cd----5Cd+2Mn+8H2O
|
|
|
the half cell potential is
|
.309V
|
|
|
In the titration of 30mL of a .200M solution....what's the pH?
|
6.00
|
|
|
Calc E for reaction...
|
+.736V
|
|
|
A 100m weak acid titrated with weak acid..correct statements are...
|
-the equivalence pt is reached when 10mL KOH added
-pH=5 when 5mL KOH added -pH=8.98 when 10mL KOH added |
|
|
for titration of 10mL of .1M dibasic base, correct statements:
|
all are correct
|
|
|
For titration of 50mL of .04M Ca+2 with EDTA, correct statements:
|
-At pH=10, the most potent complexing ligand of EDTA is a hexadentate ligand
-The equivalence pt is reached when 25mL EDTA added -pCa=5.91 at equivalence pt |
|
|
In the context of EDTA titratoin, correct statements:
|
-EDTA form more stable metal complex in basic solution
-Conditional formation constant allows us to look at EDTA complex formation as if the uncomplexed EDTA were in one form -Auxillary complexing agent permits EDTA titration in alkaline condition w/o the interfernece of metal hydroxyides precipitation |
|
|
the space shuttle...correct statements:
|
-NH4CLO4 funcs both as reducing and oxidizing agent
-Al metal powder funs as reducing agent |
|
|
In the context of electrochem cell, correct statements:
|
-reduc and oxida half rxns always occu concurrently in an electrochem cell
-the purpose of a salt bridge is to maintain electroneutrality throughout the cell -Multiplying a half-reaction by any factor does not change the value of its E |
